C30H20N3O11S- — CID 168642701
4-[2-amino-3-cyano-5,6-bis(methoxycarbonyl)-4-phenyl-4H-pyridin-1-yl]-1,3-dihydroxy-9,10-dioxoanthracene-2-sulfonate (PubChem CID 168642701) has the molecular formula C30H20N3O11S- and a molecular weight of 630.57 g/mol. Its IUPAC name is 4-[2-amino-3-cyano-5,6-bis(methoxycarbonyl)-4-phenyl-4H-pyridin-1-yl]-1,3-dihydroxy-9,10-dioxoanthracene-2-sulfonate.
| Compound Name | 4-[2-amino-3-cyano-5,6-bis(methoxycarbonyl)-4-phenyl-4H-pyridin-1-yl]-1,3-dihydroxy-9,10-dioxoanthracene-2-sulfonate |
|---|---|
| PubChem CID | 168642701 |
| Molecular Formula | C30H20N3O11S- |
| Molecular Weight | 630.57 g/mol |
| Exact Mass | 630.08 |
| IUPAC Name | 4-[2-amino-3-cyano-5,6-bis(methoxycarbonyl)-4-phenyl-4H-pyridin-1-yl]-1,3-dihydroxy-9,10-dioxoanthracene-2-sulfonate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2c(O)c(S(=O)(=O)[O-])c(O)c3c2C(=O)c2ccccc2C3=O)C(N)=C(C#N)C1c1ccccc1 |
| InChI | InChI=1S/C30H21N3O11S/c1-43-29(38)19-17(13-8-4-3-5-9-13)16(12-31)28(32)33(22(19)30(39)44-2)21-18-20(25(36)27(26(21)37)45(40,41)42)24(35)15-11-7-6-10-14(15)23(18)34/h3-11,17,36-37H,32H2,1-2H3,(H,40,41,42)/p-1 |
| InChIKey | DUOOKDUKIXRZSQ-UHFFFAOYSA-M |
| XLogP | 1.68 |
| TPSA | 237.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.57 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|