C22H15F4N3O4 — CID 168641281
dimethyl 6-amino-5-cyano-4-phenyl-1-(2,3,5,6-tetrafluorophenyl)-4H-pyridine-2,3-dicarboxylate (PubChem CID 168641281) has the molecular formula C22H15F4N3O4 and a molecular weight of 461.37 g/mol. Its IUPAC name is dimethyl 6-amino-5-cyano-4-phenyl-1-(2,3,5,6-tetrafluorophenyl)-4H-pyridine-2,3-dicarboxylate.
| Compound Name | dimethyl 6-amino-5-cyano-4-phenyl-1-(2,3,5,6-tetrafluorophenyl)-4H-pyridine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168641281 |
| Molecular Formula | C22H15F4N3O4 |
| Molecular Weight | 461.37 g/mol |
| Exact Mass | 461.10 |
| IUPAC Name | dimethyl 6-amino-5-cyano-4-phenyl-1-(2,3,5,6-tetrafluorophenyl)-4H-pyridine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2c(F)c(F)cc(F)c2F)C(N)=C(C#N)C1c1ccccc1 |
| InChI | InChI=1S/C22H15F4N3O4/c1-32-21(30)15-14(10-6-4-3-5-7-10)11(9-27)20(28)29(18(15)22(31)33-2)19-16(25)12(23)8-13(24)17(19)26/h3-8,14H,28H2,1-2H3 |
| InChIKey | ZAMNXQVLMMORAP-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 105.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.37 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|