C23H16F2N4O8 — CID 168641304
4-[2-amino-3-cyano-5,6-bis(methoxycarbonyl)-4-phenyl-4H-pyridin-1-yl]-2,3-difluoro-5-nitrobenzoic acid (PubChem CID 168641304) has the molecular formula C23H16F2N4O8 and a molecular weight of 514.40 g/mol. Its IUPAC name is 4-[2-amino-3-cyano-5,6-bis(methoxycarbonyl)-4-phenyl-4H-pyridin-1-yl]-2,3-difluoro-5-nitrobenzoic acid.
| Compound Name | 4-[2-amino-3-cyano-5,6-bis(methoxycarbonyl)-4-phenyl-4H-pyridin-1-yl]-2,3-difluoro-5-nitrobenzoic acid |
|---|---|
| PubChem CID | 168641304 |
| Molecular Formula | C23H16F2N4O8 |
| Molecular Weight | 514.40 g/mol |
| Exact Mass | 514.09 |
| IUPAC Name | 4-[2-amino-3-cyano-5,6-bis(methoxycarbonyl)-4-phenyl-4H-pyridin-1-yl]-2,3-difluoro-5-nitrobenzoic acid |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2c([N+](=O)[O-])cc(C(=O)O)c(F)c2F)C(N)=C(C#N)C1c1ccccc1 |
| InChI | InChI=1S/C23H16F2N4O8/c1-36-22(32)15-14(10-6-4-3-5-7-10)12(9-26)20(27)28(19(15)23(33)37-2)18-13(29(34)35)8-11(21(30)31)16(24)17(18)25/h3-8,14H,27H2,1-2H3,(H,30,31) |
| InChIKey | AZZSYMBJFDBGLK-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 186.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.40 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|