C23H18BrFN4O6 — CID 168643018
dimethyl 6-amino-1-(2-bromo-3-fluoro-6-methyl-4-nitrophenyl)-5-cyano-4-phenyl-4H-pyridine-2,3-dicarboxylate (PubChem CID 168643018) has the molecular formula C23H18BrFN4O6 and a molecular weight of 545.32 g/mol. Its IUPAC name is dimethyl 6-amino-1-(2-bromo-3-fluoro-6-methyl-4-nitrophenyl)-5-cyano-4-phenyl-4H-pyridine-2,3-dicarboxylate.
| Compound Name | dimethyl 6-amino-1-(2-bromo-3-fluoro-6-methyl-4-nitrophenyl)-5-cyano-4-phenyl-4H-pyridine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168643018 |
| Molecular Formula | C23H18BrFN4O6 |
| Molecular Weight | 545.32 g/mol |
| Exact Mass | 544.04 |
| IUPAC Name | dimethyl 6-amino-1-(2-bromo-3-fluoro-6-methyl-4-nitrophenyl)-5-cyano-4-phenyl-4H-pyridine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2c(C)cc([N+](=O)[O-])c(F)c2Br)C(N)=C(C#N)C1c1ccccc1 |
| InChI | InChI=1S/C23H18BrFN4O6/c1-11-9-14(29(32)33)18(25)17(24)19(11)28-20(23(31)35-3)16(22(30)34-2)15(13(10-26)21(28)27)12-7-5-4-6-8-12/h4-9,15H,27H2,1-3H3 |
| InChIKey | AWPRWRWCDXHAAA-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 148.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.32 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|