C23H16BrF3N4O7 — CID 168642166
dimethyl 6-amino-1-[5-bromo-2-nitro-4-(trifluoromethoxy)phenyl]-5-cyano-4-phenyl-4H-pyridine-2,3-dicarboxylate (PubChem CID 168642166) has the molecular formula C23H16BrF3N4O7 and a molecular weight of 597.30 g/mol. Its IUPAC name is dimethyl 6-amino-1-[5-bromo-2-nitro-4-(trifluoromethoxy)phenyl]-5-cyano-4-phenyl-4H-pyridine-2,3-dicarboxylate.
| Compound Name | dimethyl 6-amino-1-[5-bromo-2-nitro-4-(trifluoromethoxy)phenyl]-5-cyano-4-phenyl-4H-pyridine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168642166 |
| Molecular Formula | C23H16BrF3N4O7 |
| Molecular Weight | 597.30 g/mol |
| Exact Mass | 596.02 |
| IUPAC Name | dimethyl 6-amino-1-[5-bromo-2-nitro-4-(trifluoromethoxy)phenyl]-5-cyano-4-phenyl-4H-pyridine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2cc(Br)c(OC(F)(F)F)cc2[N+](=O)[O-])C(N)=C(C#N)C1c1ccccc1 |
| InChI | InChI=1S/C23H16BrF3N4O7/c1-36-21(32)18-17(11-6-4-3-5-7-11)12(10-28)20(29)30(19(18)22(33)37-2)14-8-13(24)16(38-23(25,26)27)9-15(14)31(34)35/h3-9,17H,29H2,1-2H3 |
| InChIKey | IHFXKSFAZUAOJZ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 158.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.30 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|