C23H17F3N4O8S — CID 168644832
dimethyl 6-amino-5-cyano-1-[2-nitro-4-(trifluoromethylsulfonyl)phenyl]-4-phenyl-4H-pyridine-2,3-dicarboxylate (PubChem CID 168644832) has the molecular formula C23H17F3N4O8S and a molecular weight of 566.47 g/mol. Its IUPAC name is dimethyl 6-amino-5-cyano-1-[2-nitro-4-(trifluoromethylsulfonyl)phenyl]-4-phenyl-4H-pyridine-2,3-dicarboxylate.
| Compound Name | dimethyl 6-amino-5-cyano-1-[2-nitro-4-(trifluoromethylsulfonyl)phenyl]-4-phenyl-4H-pyridine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168644832 |
| Molecular Formula | C23H17F3N4O8S |
| Molecular Weight | 566.47 g/mol |
| Exact Mass | 566.07 |
| IUPAC Name | dimethyl 6-amino-5-cyano-1-[2-nitro-4-(trifluoromethylsulfonyl)phenyl]-4-phenyl-4H-pyridine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2ccc(S(=O)(=O)C(F)(F)F)cc2[N+](=O)[O-])C(N)=C(C#N)C1c1ccccc1 |
| InChI | InChI=1S/C23H17F3N4O8S/c1-37-21(31)18-17(12-6-4-3-5-7-12)14(11-27)20(28)29(19(18)22(32)38-2)15-9-8-13(10-16(15)30(33)34)39(35,36)23(24,25)26/h3-10,17H,28H2,1-2H3 |
| InChIKey | LXGBBXNPJZBFNR-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 182.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.47 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|