C23H18N4O8 — CID 168643241
dimethyl 6-amino-5-cyano-1-(6-nitro-1,3-benzodioxol-5-yl)-4-phenyl-4H-pyridine-2,3-dicarboxylate (PubChem CID 168643241) has the molecular formula C23H18N4O8 and a molecular weight of 478.42 g/mol. Its IUPAC name is dimethyl 6-amino-5-cyano-1-(6-nitro-1,3-benzodioxol-5-yl)-4-phenyl-4H-pyridine-2,3-dicarboxylate.
| Compound Name | dimethyl 6-amino-5-cyano-1-(6-nitro-1,3-benzodioxol-5-yl)-4-phenyl-4H-pyridine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168643241 |
| Molecular Formula | C23H18N4O8 |
| Molecular Weight | 478.42 g/mol |
| Exact Mass | 478.11 |
| IUPAC Name | dimethyl 6-amino-5-cyano-1-(6-nitro-1,3-benzodioxol-5-yl)-4-phenyl-4H-pyridine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2cc3c(cc2[N+](=O)[O-])OCO3)C(N)=C(C#N)C1c1ccccc1 |
| InChI | InChI=1S/C23H18N4O8/c1-32-22(28)19-18(12-6-4-3-5-7-12)13(10-24)21(25)26(20(19)23(29)33-2)14-8-16-17(35-11-34-16)9-15(14)27(30)31/h3-9,18H,11,25H2,1-2H3 |
| InChIKey | XDVMBBJMEFRIRE-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 167.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.42 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|