C29H30N6O8 — CID 168643200
dimethyl 6-amino-5-cyano-1-[5-(4-ethoxycarbonylpiperazin-1-yl)-2-nitrophenyl]-4-phenyl-4H-pyridine-2,3-dicarboxylate (PubChem CID 168643200) has the molecular formula C29H30N6O8 and a molecular weight of 590.59 g/mol. Its IUPAC name is dimethyl 6-amino-5-cyano-1-[5-(4-ethoxycarbonylpiperazin-1-yl)-2-nitrophenyl]-4-phenyl-4H-pyridine-2,3-dicarboxylate.
| Compound Name | dimethyl 6-amino-5-cyano-1-[5-(4-ethoxycarbonylpiperazin-1-yl)-2-nitrophenyl]-4-phenyl-4H-pyridine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168643200 |
| Molecular Formula | C29H30N6O8 |
| Molecular Weight | 590.59 g/mol |
| Exact Mass | 590.21 |
| IUPAC Name | dimethyl 6-amino-5-cyano-1-[5-(4-ethoxycarbonylpiperazin-1-yl)-2-nitrophenyl]-4-phenyl-4H-pyridine-2,3-dicarboxylate |
| SMILES | CCOC(=O)N1CCN(c2ccc([N+](=O)[O-])c(N3C(N)=C(C#N)C(c4ccccc4)C(C(=O)OC)=C3C(=O)OC)c2)CC1 |
| InChI | InChI=1S/C29H30N6O8/c1-4-43-29(38)33-14-12-32(13-15-33)19-10-11-21(35(39)40)22(16-19)34-25(28(37)42-3)24(27(36)41-2)23(20(17-30)26(34)31)18-8-6-5-7-9-18/h5-11,16,23H,4,12-15,31H2,1-3H3 |
| InChIKey | CADGTNWNTPABME-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 181.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.59 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|