C29H31N5O5 — CID 168642557
dimethyl 1-[4-(4-acetyl-1,4-diazepan-1-yl)phenyl]-6-amino-5-cyano-4-phenyl-4H-pyridine-2,3-dicarboxylate (PubChem CID 168642557) has the molecular formula C29H31N5O5 and a molecular weight of 529.60 g/mol. Its IUPAC name is dimethyl 1-[4-(4-acetyl-1,4-diazepan-1-yl)phenyl]-6-amino-5-cyano-4-phenyl-4H-pyridine-2,3-dicarboxylate.
| Compound Name | dimethyl 1-[4-(4-acetyl-1,4-diazepan-1-yl)phenyl]-6-amino-5-cyano-4-phenyl-4H-pyridine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168642557 |
| Molecular Formula | C29H31N5O5 |
| Molecular Weight | 529.60 g/mol |
| Exact Mass | 529.23 |
| IUPAC Name | dimethyl 1-[4-(4-acetyl-1,4-diazepan-1-yl)phenyl]-6-amino-5-cyano-4-phenyl-4H-pyridine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2ccc(N3CCCN(C(C)=O)CC3)cc2)C(N)=C(C#N)C1c1ccccc1 |
| InChI | InChI=1S/C29H31N5O5/c1-19(35)32-14-7-15-33(17-16-32)21-10-12-22(13-11-21)34-26(29(37)39-3)25(28(36)38-2)24(23(18-30)27(34)31)20-8-5-4-6-9-20/h4-6,8-13,24H,7,14-17,31H2,1-3H3 |
| InChIKey | ARYXAHFRXGKPKF-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 129.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.60 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|