C23H18ClN3O5 — CID 168644691
dimethyl 6-amino-1-(4-carbonochloridoylphenyl)-5-cyano-4-phenyl-4H-pyridine-2,3-dicarboxylate (PubChem CID 168644691) has the molecular formula C23H18ClN3O5 and a molecular weight of 451.87 g/mol. Its IUPAC name is dimethyl 6-amino-1-(4-carbonochloridoylphenyl)-5-cyano-4-phenyl-4H-pyridine-2,3-dicarboxylate.
| Compound Name | dimethyl 6-amino-1-(4-carbonochloridoylphenyl)-5-cyano-4-phenyl-4H-pyridine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168644691 |
| Molecular Formula | C23H18ClN3O5 |
| Molecular Weight | 451.87 g/mol |
| Exact Mass | 451.09 |
| IUPAC Name | dimethyl 6-amino-1-(4-carbonochloridoylphenyl)-5-cyano-4-phenyl-4H-pyridine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2ccc(C(=O)Cl)cc2)C(N)=C(C#N)C1c1ccccc1 |
| InChI | InChI=1S/C23H18ClN3O5/c1-31-22(29)18-17(13-6-4-3-5-7-13)16(12-25)21(26)27(19(18)23(30)32-2)15-10-8-14(9-11-15)20(24)28/h3-11,17H,26H2,1-2H3 |
| InChIKey | HBPVFRBYVZZFLU-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 122.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.87 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|