C22H20BN3O6 — CID 168641208
[4-[2-amino-3-cyano-5,6-bis(methoxycarbonyl)-4-phenyl-4H-pyridin-1-yl]phenyl]boronic acid (PubChem CID 168641208) has the molecular formula C22H20BN3O6 and a molecular weight of 433.23 g/mol. Its IUPAC name is [4-[2-amino-3-cyano-5,6-bis(methoxycarbonyl)-4-phenyl-4H-pyridin-1-yl]phenyl]boronic acid.
| Compound Name | [4-[2-amino-3-cyano-5,6-bis(methoxycarbonyl)-4-phenyl-4H-pyridin-1-yl]phenyl]boronic acid |
|---|---|
| PubChem CID | 168641208 |
| Molecular Formula | C22H20BN3O6 |
| Molecular Weight | 433.23 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | [4-[2-amino-3-cyano-5,6-bis(methoxycarbonyl)-4-phenyl-4H-pyridin-1-yl]phenyl]boronic acid |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2ccc(B(O)O)cc2)C(N)=C(C#N)C1c1ccccc1 |
| InChI | InChI=1S/C22H20BN3O6/c1-31-21(27)18-17(13-6-4-3-5-7-13)16(12-24)20(25)26(19(18)22(28)32-2)15-10-8-14(9-11-15)23(29)30/h3-11,17,29-30H,25H2,1-2H3 |
| InChIKey | DZEHQUKAMIMCOX-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 146.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.23 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|