C28H24BN3O7 — CID 168642509
[4-[4-[2-amino-3-cyano-5,6-bis(methoxycarbonyl)-4-phenyl-4H-pyridin-1-yl]phenoxy]phenyl]boronic acid (PubChem CID 168642509) has the molecular formula C28H24BN3O7 and a molecular weight of 525.33 g/mol. Its IUPAC name is [4-[4-[2-amino-3-cyano-5,6-bis(methoxycarbonyl)-4-phenyl-4H-pyridin-1-yl]phenoxy]phenyl]boronic acid.
| Compound Name | [4-[4-[2-amino-3-cyano-5,6-bis(methoxycarbonyl)-4-phenyl-4H-pyridin-1-yl]phenoxy]phenyl]boronic acid |
|---|---|
| PubChem CID | 168642509 |
| Molecular Formula | C28H24BN3O7 |
| Molecular Weight | 525.33 g/mol |
| Exact Mass | 525.17 |
| IUPAC Name | [4-[4-[2-amino-3-cyano-5,6-bis(methoxycarbonyl)-4-phenyl-4H-pyridin-1-yl]phenoxy]phenyl]boronic acid |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2ccc(Oc3ccc(B(O)O)cc3)cc2)C(N)=C(C#N)C1c1ccccc1 |
| InChI | InChI=1S/C28H24BN3O7/c1-37-27(33)24-23(17-6-4-3-5-7-17)22(16-30)26(31)32(25(24)28(34)38-2)19-10-14-21(15-11-19)39-20-12-8-18(9-13-20)29(35)36/h3-15,23,35-36H,31H2,1-2H3 |
| InChIKey | YMINXAHHEDAISC-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 155.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.33 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|