C22H17I2N3O4 — CID 168643021
dimethyl 6-amino-5-cyano-1-(3,5-diiodophenyl)-4-phenyl-4H-pyridine-2,3-dicarboxylate (PubChem CID 168643021) has the molecular formula C22H17I2N3O4 and a molecular weight of 641.20 g/mol. Its IUPAC name is dimethyl 6-amino-5-cyano-1-(3,5-diiodophenyl)-4-phenyl-4H-pyridine-2,3-dicarboxylate.
| Compound Name | dimethyl 6-amino-5-cyano-1-(3,5-diiodophenyl)-4-phenyl-4H-pyridine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168643021 |
| Molecular Formula | C22H17I2N3O4 |
| Molecular Weight | 641.20 g/mol |
| Exact Mass | 640.93 |
| IUPAC Name | dimethyl 6-amino-5-cyano-1-(3,5-diiodophenyl)-4-phenyl-4H-pyridine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2cc(I)cc(I)c2)C(N)=C(C#N)C1c1ccccc1 |
| InChI | InChI=1S/C22H17I2N3O4/c1-30-21(28)18-17(12-6-4-3-5-7-12)16(11-25)20(26)27(19(18)22(29)31-2)15-9-13(23)8-14(24)10-15/h3-10,17H,26H2,1-2H3 |
| InChIKey | QRRRMWGPZVSJRK-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 105.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.20 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|