C30H31N3O8 — CID 168645628
dimethyl 6-amino-1-[3,5-bis(propan-2-yloxycarbonyl)phenyl]-5-cyano-4-phenyl-4H-pyridine-2,3-dicarboxylate (PubChem CID 168645628) has the molecular formula C30H31N3O8 and a molecular weight of 561.59 g/mol. Its IUPAC name is dimethyl 6-amino-1-[3,5-bis(propan-2-yloxycarbonyl)phenyl]-5-cyano-4-phenyl-4H-pyridine-2,3-dicarboxylate.
| Compound Name | dimethyl 6-amino-1-[3,5-bis(propan-2-yloxycarbonyl)phenyl]-5-cyano-4-phenyl-4H-pyridine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168645628 |
| Molecular Formula | C30H31N3O8 |
| Molecular Weight | 561.59 g/mol |
| Exact Mass | 561.21 |
| IUPAC Name | dimethyl 6-amino-1-[3,5-bis(propan-2-yloxycarbonyl)phenyl]-5-cyano-4-phenyl-4H-pyridine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2cc(C(=O)OC(C)C)cc(C(=O)OC(C)C)c2)C(N)=C(C#N)C1c1ccccc1 |
| InChI | InChI=1S/C30H31N3O8/c1-16(2)40-27(34)19-12-20(28(35)41-17(3)4)14-21(13-19)33-25(30(37)39-6)24(29(36)38-5)23(22(15-31)26(33)32)18-10-8-7-9-11-18/h7-14,16-17,23H,32H2,1-6H3 |
| InChIKey | GMNMDYLWCWDIFZ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 158.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.59 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|