C24H20ClN3O6 — CID 168641260
dimethyl 6-amino-1-(4-chloro-3-methoxycarbonylphenyl)-5-cyano-4-phenyl-4H-pyridine-2,3-dicarboxylate (PubChem CID 168641260) has the molecular formula C24H20ClN3O6 and a molecular weight of 481.89 g/mol. Its IUPAC name is dimethyl 6-amino-1-(4-chloro-3-methoxycarbonylphenyl)-5-cyano-4-phenyl-4H-pyridine-2,3-dicarboxylate.
| Compound Name | dimethyl 6-amino-1-(4-chloro-3-methoxycarbonylphenyl)-5-cyano-4-phenyl-4H-pyridine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168641260 |
| Molecular Formula | C24H20ClN3O6 |
| Molecular Weight | 481.89 g/mol |
| Exact Mass | 481.10 |
| IUPAC Name | dimethyl 6-amino-1-(4-chloro-3-methoxycarbonylphenyl)-5-cyano-4-phenyl-4H-pyridine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2ccc(Cl)c(C(=O)OC)c2)C(N)=C(C#N)C1c1ccccc1 |
| InChI | InChI=1S/C24H20ClN3O6/c1-32-22(29)15-11-14(9-10-17(15)25)28-20(24(31)34-3)19(23(30)33-2)18(16(12-26)21(28)27)13-7-5-4-6-8-13/h4-11,18H,27H2,1-3H3 |
| InChIKey | UYSMAXVMCQUZPS-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 131.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.89 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|