C30H25N3O6 — CID 168643329
dimethyl 6-amino-5-cyano-1-[4-(3-methoxycarbonylphenyl)phenyl]-4-phenyl-4H-pyridine-2,3-dicarboxylate (PubChem CID 168643329) has the molecular formula C30H25N3O6 and a molecular weight of 523.55 g/mol. Its IUPAC name is dimethyl 6-amino-5-cyano-1-[4-(3-methoxycarbonylphenyl)phenyl]-4-phenyl-4H-pyridine-2,3-dicarboxylate.
| Compound Name | dimethyl 6-amino-5-cyano-1-[4-(3-methoxycarbonylphenyl)phenyl]-4-phenyl-4H-pyridine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168643329 |
| Molecular Formula | C30H25N3O6 |
| Molecular Weight | 523.55 g/mol |
| Exact Mass | 523.17 |
| IUPAC Name | dimethyl 6-amino-5-cyano-1-[4-(3-methoxycarbonylphenyl)phenyl]-4-phenyl-4H-pyridine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2ccc(-c3cccc(C(=O)OC)c3)cc2)C(N)=C(C#N)C1c1ccccc1 |
| InChI | InChI=1S/C30H25N3O6/c1-37-28(34)21-11-7-10-20(16-21)18-12-14-22(15-13-18)33-26(30(36)39-3)25(29(35)38-2)24(23(17-31)27(33)32)19-8-5-4-6-9-19/h4-16,24H,32H2,1-3H3 |
| InChIKey | BDWQPXPWMKVWMI-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 131.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.55 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|