C23H20IN3O5 — CID 168642685
dimethyl 6-amino-5-cyano-1-(4-iodo-3-methoxyphenyl)-4-phenyl-4H-pyridine-2,3-dicarboxylate (PubChem CID 168642685) has the molecular formula C23H20IN3O5 and a molecular weight of 545.33 g/mol. Its IUPAC name is dimethyl 6-amino-5-cyano-1-(4-iodo-3-methoxyphenyl)-4-phenyl-4H-pyridine-2,3-dicarboxylate.
| Compound Name | dimethyl 6-amino-5-cyano-1-(4-iodo-3-methoxyphenyl)-4-phenyl-4H-pyridine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168642685 |
| Molecular Formula | C23H20IN3O5 |
| Molecular Weight | 545.33 g/mol |
| Exact Mass | 545.04 |
| IUPAC Name | dimethyl 6-amino-5-cyano-1-(4-iodo-3-methoxyphenyl)-4-phenyl-4H-pyridine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2ccc(I)c(OC)c2)C(N)=C(C#N)C1c1ccccc1 |
| InChI | InChI=1S/C23H20IN3O5/c1-30-17-11-14(9-10-16(17)24)27-20(23(29)32-3)19(22(28)31-2)18(15(12-25)21(27)26)13-7-5-4-6-8-13/h4-11,18H,26H2,1-3H3 |
| InChIKey | IRPMNTRJTMUUHF-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 114.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.33 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|