C22H17IN4O6 — CID 168641584
dimethyl 6-amino-5-cyano-1-(4-iodo-3-nitrophenyl)-4-phenyl-4H-pyridine-2,3-dicarboxylate (PubChem CID 168641584) has the molecular formula C22H17IN4O6 and a molecular weight of 560.30 g/mol. Its IUPAC name is dimethyl 6-amino-5-cyano-1-(4-iodo-3-nitrophenyl)-4-phenyl-4H-pyridine-2,3-dicarboxylate.
| Compound Name | dimethyl 6-amino-5-cyano-1-(4-iodo-3-nitrophenyl)-4-phenyl-4H-pyridine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168641584 |
| Molecular Formula | C22H17IN4O6 |
| Molecular Weight | 560.30 g/mol |
| Exact Mass | 560.02 |
| IUPAC Name | dimethyl 6-amino-5-cyano-1-(4-iodo-3-nitrophenyl)-4-phenyl-4H-pyridine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2ccc(I)c([N+](=O)[O-])c2)C(N)=C(C#N)C1c1ccccc1 |
| InChI | InChI=1S/C22H17IN4O6/c1-32-21(28)18-17(12-6-4-3-5-7-12)14(11-24)20(25)26(19(18)22(29)33-2)13-8-9-15(23)16(10-13)27(30)31/h3-10,17H,25H2,1-2H3 |
| InChIKey | IGYBBQQOFIANCJ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 148.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.30 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|