C22H18N4O7 — CID 168645826
dimethyl 6-amino-5-cyano-1-(4-hydroxy-2-nitrophenyl)-4-phenyl-4H-pyridine-2,3-dicarboxylate (PubChem CID 168645826) has the molecular formula C22H18N4O7 and a molecular weight of 450.41 g/mol. Its IUPAC name is dimethyl 6-amino-5-cyano-1-(4-hydroxy-2-nitrophenyl)-4-phenyl-4H-pyridine-2,3-dicarboxylate.
| Compound Name | dimethyl 6-amino-5-cyano-1-(4-hydroxy-2-nitrophenyl)-4-phenyl-4H-pyridine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168645826 |
| Molecular Formula | C22H18N4O7 |
| Molecular Weight | 450.41 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | dimethyl 6-amino-5-cyano-1-(4-hydroxy-2-nitrophenyl)-4-phenyl-4H-pyridine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2ccc(O)cc2[N+](=O)[O-])C(N)=C(C#N)C1c1ccccc1 |
| InChI | InChI=1S/C22H18N4O7/c1-32-21(28)18-17(12-6-4-3-5-7-12)14(11-23)20(24)25(19(18)22(29)33-2)15-9-8-13(27)10-16(15)26(30)31/h3-10,17,27H,24H2,1-2H3 |
| InChIKey | HQBOQNNAOXWRNV-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 169.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.41 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|