C24H22N4O7 — CID 168641484
dimethyl 6-amino-5-cyano-1-(5-ethoxy-2-nitrophenyl)-4-phenyl-4H-pyridine-2,3-dicarboxylate (PubChem CID 168641484) has the molecular formula C24H22N4O7 and a molecular weight of 478.46 g/mol. Its IUPAC name is dimethyl 6-amino-5-cyano-1-(5-ethoxy-2-nitrophenyl)-4-phenyl-4H-pyridine-2,3-dicarboxylate.
| Compound Name | dimethyl 6-amino-5-cyano-1-(5-ethoxy-2-nitrophenyl)-4-phenyl-4H-pyridine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168641484 |
| Molecular Formula | C24H22N4O7 |
| Molecular Weight | 478.46 g/mol |
| Exact Mass | 478.15 |
| IUPAC Name | dimethyl 6-amino-5-cyano-1-(5-ethoxy-2-nitrophenyl)-4-phenyl-4H-pyridine-2,3-dicarboxylate |
| SMILES | CCOc1ccc([N+](=O)[O-])c(N2C(N)=C(C#N)C(c3ccccc3)C(C(=O)OC)=C2C(=O)OC)c1 |
| InChI | InChI=1S/C24H22N4O7/c1-4-35-15-10-11-17(28(31)32)18(12-15)27-21(24(30)34-3)20(23(29)33-2)19(16(13-25)22(27)26)14-8-6-5-7-9-14/h5-12,19H,4,26H2,1-3H3 |
| InChIKey | AVPJQAWMGBGHLZ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 158.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.46 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|