C27H24FN5O7 — CID 168645116
dimethyl 6-amino-5-cyano-1-[4-fluoro-5-nitro-2-(4-oxopent-2-en-2-ylamino)phenyl]-4-phenyl-4H-pyridine-2,3-dicarboxylate (PubChem CID 168645116) has the molecular formula C27H24FN5O7 and a molecular weight of 549.52 g/mol. Its IUPAC name is dimethyl 6-amino-5-cyano-1-[4-fluoro-5-nitro-2-(4-oxopent-2-en-2-ylamino)phenyl]-4-phenyl-4H-pyridine-2,3-dicarboxylate.
| Compound Name | dimethyl 6-amino-5-cyano-1-[4-fluoro-5-nitro-2-(4-oxopent-2-en-2-ylamino)phenyl]-4-phenyl-4H-pyridine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168645116 |
| Molecular Formula | C27H24FN5O7 |
| Molecular Weight | 549.52 g/mol |
| Exact Mass | 549.17 |
| IUPAC Name | dimethyl 6-amino-5-cyano-1-[4-fluoro-5-nitro-2-(4-oxopent-2-en-2-ylamino)phenyl]-4-phenyl-4H-pyridine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2cc([N+](=O)[O-])c(F)cc2NC(C)=CC(C)=O)C(N)=C(C#N)C1c1ccccc1 |
| InChI | InChI=1S/C27H24FN5O7/c1-14(10-15(2)34)31-19-11-18(28)20(33(37)38)12-21(19)32-24(27(36)40-4)23(26(35)39-3)22(17(13-29)25(32)30)16-8-6-5-7-9-16/h5-12,22,31H,30H2,1-4H3 |
| InChIKey | JHJRAQRCLYISAW-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 177.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.52 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|