C29H33N5O4 — CID 168643399
dimethyl 6-amino-5-cyano-4-phenyl-1-[4-(4-propan-2-ylpiperazin-1-yl)phenyl]-4H-pyridine-2,3-dicarboxylate (PubChem CID 168643399) has the molecular formula C29H33N5O4 and a molecular weight of 515.61 g/mol. Its IUPAC name is dimethyl 6-amino-5-cyano-4-phenyl-1-[4-(4-propan-2-ylpiperazin-1-yl)phenyl]-4H-pyridine-2,3-dicarboxylate.
| Compound Name | dimethyl 6-amino-5-cyano-4-phenyl-1-[4-(4-propan-2-ylpiperazin-1-yl)phenyl]-4H-pyridine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168643399 |
| Molecular Formula | C29H33N5O4 |
| Molecular Weight | 515.61 g/mol |
| Exact Mass | 515.25 |
| IUPAC Name | dimethyl 6-amino-5-cyano-4-phenyl-1-[4-(4-propan-2-ylpiperazin-1-yl)phenyl]-4H-pyridine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2ccc(N3CCN(C(C)C)CC3)cc2)C(N)=C(C#N)C1c1ccccc1 |
| InChI | InChI=1S/C29H33N5O4/c1-19(2)32-14-16-33(17-15-32)21-10-12-22(13-11-21)34-26(29(36)38-4)25(28(35)37-3)24(23(18-30)27(34)31)20-8-6-5-7-9-20/h5-13,19,24H,14-17,31H2,1-4H3 |
| InChIKey | LOEILJRMJIBURK-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 112.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.61 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|