C28H30N4O5 — CID 168642386
dimethyl 6-amino-5-cyano-1-[4-(2,6-dimethylmorpholin-4-yl)phenyl]-4-phenyl-4H-pyridine-2,3-dicarboxylate (PubChem CID 168642386) has the molecular formula C28H30N4O5 and a molecular weight of 502.57 g/mol. Its IUPAC name is dimethyl 6-amino-5-cyano-1-[4-(2,6-dimethylmorpholin-4-yl)phenyl]-4-phenyl-4H-pyridine-2,3-dicarboxylate.
| Compound Name | dimethyl 6-amino-5-cyano-1-[4-(2,6-dimethylmorpholin-4-yl)phenyl]-4-phenyl-4H-pyridine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168642386 |
| Molecular Formula | C28H30N4O5 |
| Molecular Weight | 502.57 g/mol |
| Exact Mass | 502.22 |
| IUPAC Name | dimethyl 6-amino-5-cyano-1-[4-(2,6-dimethylmorpholin-4-yl)phenyl]-4-phenyl-4H-pyridine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2ccc(N3CC(C)OC(C)C3)cc2)C(N)=C(C#N)C1c1ccccc1 |
| InChI | InChI=1S/C28H30N4O5/c1-17-15-31(16-18(2)37-17)20-10-12-21(13-11-20)32-25(28(34)36-4)24(27(33)35-3)23(22(14-29)26(32)30)19-8-6-5-7-9-19/h5-13,17-18,23H,15-16,30H2,1-4H3 |
| InChIKey | PPLPZPBOIJYXPR-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 118.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.57 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|