C23H18BrN5O7 — CID 168642469
dimethyl 6-amino-1-(2-bromo-4-carbamoyl-6-nitrophenyl)-5-cyano-4-phenyl-4H-pyridine-2,3-dicarboxylate (PubChem CID 168642469) has the molecular formula C23H18BrN5O7 and a molecular weight of 556.33 g/mol. Its IUPAC name is dimethyl 6-amino-1-(2-bromo-4-carbamoyl-6-nitrophenyl)-5-cyano-4-phenyl-4H-pyridine-2,3-dicarboxylate.
| Compound Name | dimethyl 6-amino-1-(2-bromo-4-carbamoyl-6-nitrophenyl)-5-cyano-4-phenyl-4H-pyridine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168642469 |
| Molecular Formula | C23H18BrN5O7 |
| Molecular Weight | 556.33 g/mol |
| Exact Mass | 555.04 |
| IUPAC Name | dimethyl 6-amino-1-(2-bromo-4-carbamoyl-6-nitrophenyl)-5-cyano-4-phenyl-4H-pyridine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2c(Br)cc(C(N)=O)cc2[N+](=O)[O-])C(N)=C(C#N)C1c1ccccc1 |
| InChI | InChI=1S/C23H18BrN5O7/c1-35-22(31)17-16(11-6-4-3-5-7-11)13(10-25)20(26)28(19(17)23(32)36-2)18-14(24)8-12(21(27)30)9-15(18)29(33)34/h3-9,16H,26H2,1-2H3,(H2,27,30) |
| InChIKey | PMYVISIHBZFWBL-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 191.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.33 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|