C20H12Na2O11S2 — CID 170846965
CID 170846965 (PubChem CID 170846965) has the molecular formula C20H12Na2O11S2 and a molecular weight of 538.42 g/mol.
| Compound Name | CID 170846965 |
|---|---|
| PubChem CID | 170846965 |
| Molecular Formula | C20H12Na2O11S2 |
| Molecular Weight | 538.42 g/mol |
| Exact Mass | 537.96 |
| IUPAC Name | — |
| SMILES | O=C1c2ccccc2C(=O)c2c(O)c(S(=O)(=O)O)c(Oc3ccc(S(=O)(=O)O)cc3)c(O)c21.[Na].[Na] |
| InChI | InChI=1S/C20H12O11S2.2Na/c21-15-11-3-1-2-4-12(11)16(22)14-13(15)17(23)19(20(18(14)24)33(28,29)30)31-9-5-7-10(8-6-9)32(25,26)27;;/h1-8,23-24H,(H,25,26,27)(H,28,29,30);; |
| InChIKey | NTRQIQYICJYTDE-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 192.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.42 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|