C26H12N2O6 — CID 13330620
2-[3-(1,3-dioxoisoindol-2-yl)-1,4-dioxonaphthalen-2-yl]isoindole-1,3-dione (PubChem CID 13330620) has the molecular formula C26H12N2O6 and a molecular weight of 448.39 g/mol. Its IUPAC name is 2-[3-(1,3-dioxoisoindol-2-yl)-1,4-dioxonaphthalen-2-yl]isoindole-1,3-dione.
| Compound Name | 2-[3-(1,3-dioxoisoindol-2-yl)-1,4-dioxonaphthalen-2-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 13330620 |
| Molecular Formula | C26H12N2O6 |
| Molecular Weight | 448.39 g/mol |
| Exact Mass | 448.07 |
| IUPAC Name | 2-[3-(1,3-dioxoisoindol-2-yl)-1,4-dioxonaphthalen-2-yl]isoindole-1,3-dione |
| SMILES | O=C1C(N2C(=O)c3ccccc3C2=O)=C(N2C(=O)c3ccccc3C2=O)C(=O)c2ccccc21 |
| InChI | InChI=1S/C26H12N2O6/c29-21-13-7-1-2-8-14(13)22(30)20(28-25(33)17-11-5-6-12-18(17)26(28)34)19(21)27-23(31)15-9-3-4-10-16(15)24(27)32/h1-12H |
| InChIKey | IKKXDKMFQBUKEX-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 108.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.39 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|