C24H10N4O5 — CID 91316415
4-(1,3-dioxoisoindol-2-yl)-3,6-dioxo-5-(3-oxo-1H-isoindol-2-yl)cyclohexa-1,4-diene-1,2-dicarbonitrile (PubChem CID 91316415) has the molecular formula C24H10N4O5 and a molecular weight of 434.37 g/mol. Its IUPAC name is 4-(1,3-dioxoisoindol-2-yl)-3,6-dioxo-5-(3-oxo-1H-isoindol-2-yl)cyclohexa-1,4-diene-1,2-dicarbonitrile.
| Compound Name | 4-(1,3-dioxoisoindol-2-yl)-3,6-dioxo-5-(3-oxo-1H-isoindol-2-yl)cyclohexa-1,4-diene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 91316415 |
| Molecular Formula | C24H10N4O5 |
| Molecular Weight | 434.37 g/mol |
| Exact Mass | 434.07 |
| IUPAC Name | 4-(1,3-dioxoisoindol-2-yl)-3,6-dioxo-5-(3-oxo-1H-isoindol-2-yl)cyclohexa-1,4-diene-1,2-dicarbonitrile |
| SMILES | N#CC1=C(C#N)C(=O)C(N2C(=O)c3ccccc3C2=O)=C(N2Cc3ccccc3C2=O)C1=O |
| InChI | InChI=1S/C24H10N4O5/c25-9-16-17(10-26)21(30)19(28-23(32)14-7-3-4-8-15(14)24(28)33)18(20(16)29)27-11-12-5-1-2-6-13(12)22(27)31/h1-8H,11H2 |
| InChIKey | BQELNARHWIPCTK-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 139.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.37 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|