C15H9NO2 — CID 66552597
9-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),2,4,6,12,14-hexaene-10,11-dione (PubChem CID 66552597) has the molecular formula C15H9NO2 and a molecular weight of 235.24 g/mol. Its IUPAC name is 9-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),2,4,6,12,14-hexaene-10,11-dione.
| Compound Name | 9-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),2,4,6,12,14-hexaene-10,11-dione |
|---|---|
| PubChem CID | 66552597 |
| Molecular Formula | C15H9NO2 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | 9-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),2,4,6,12,14-hexaene-10,11-dione |
| SMILES | O=C1C(=O)N2Cc3ccccc3-c3cccc1c32 |
| InChI | InChI=1S/C15H9NO2/c17-14-12-7-3-6-11-10-5-2-1-4-9(10)8-16(13(11)12)15(14)18/h1-7H,8H2 |
| InChIKey | CDMASDRKYLKORT-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|