C19H16N2O2 — CID 11738255
(3S)-1,7-diazapentacyclo[11.7.1.03,7.09,21.014,19]henicosa-9,11,13(21),14,16,18-hexaene-2,8-dione (PubChem CID 11738255) has the molecular formula C19H16N2O2 and a molecular weight of 304.35 g/mol. Its IUPAC name is (3S)-1,7-diazapentacyclo[11.7.1.03,7.09,21.014,19]henicosa-9,11,13(21),14,16,18-hexaene-2,8-dione.
| Compound Name | (3S)-1,7-diazapentacyclo[11.7.1.03,7.09,21.014,19]henicosa-9,11,13(21),14,16,18-hexaene-2,8-dione |
|---|---|
| PubChem CID | 11738255 |
| Molecular Formula | C19H16N2O2 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | (3S)-1,7-diazapentacyclo[11.7.1.03,7.09,21.014,19]henicosa-9,11,13(21),14,16,18-hexaene-2,8-dione |
| SMILES | O=C1[C@@H]2CCCN2C(=O)c2cccc3c2N1Cc1ccccc1-3 |
| InChI | InChI=1S/C19H16N2O2/c22-18-15-8-3-7-14-13-6-2-1-5-12(13)11-21(17(14)15)19(23)16-9-4-10-20(16)18/h1-3,5-8,16H,4,9-11H2/t16-/m0/s1 |
| InChIKey | RFWBQCDFGWLFTK-INIZCTEOSA-N |
| XLogP | 2.82 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |