C13H14N3O3- — CID 163486436
4-amino-2-(1-oxido-2-oxopiperidin-3-yl)-3H-isoindol-1-one (PubChem CID 163486436) has the molecular formula C13H14N3O3- and a molecular weight of 260.27 g/mol. Its IUPAC name is 4-amino-2-(1-oxido-2-oxopiperidin-3-yl)-3H-isoindol-1-one.
| Compound Name | 4-amino-2-(1-oxido-2-oxopiperidin-3-yl)-3H-isoindol-1-one |
|---|---|
| PubChem CID | 163486436 |
| Molecular Formula | C13H14N3O3- |
| Molecular Weight | 260.27 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 4-amino-2-(1-oxido-2-oxopiperidin-3-yl)-3H-isoindol-1-one |
| SMILES | Nc1cccc2c1CN(C1CCCN([O-])C1=O)C2=O |
| InChI | InChI=1S/C13H14N3O3/c14-10-4-1-3-8-9(10)7-15(12(8)17)11-5-2-6-16(19)13(11)18/h1,3-4,11H,2,5-7,14H2/q-1 |
| InChIKey | BMMKLAFCPOANEF-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.27 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|