C21H29N3O4 — CID 169257394
3-(7-amino-3-oxo-1H-isoindol-2-yl)-1-(4-butan-2-yloxybutyl)piperidine-2,6-dione (PubChem CID 169257394) has the molecular formula C21H29N3O4 and a molecular weight of 387.48 g/mol. Its IUPAC name is 3-(7-amino-3-oxo-1H-isoindol-2-yl)-1-(4-butan-2-yloxybutyl)piperidine-2,6-dione.
| Compound Name | 3-(7-amino-3-oxo-1H-isoindol-2-yl)-1-(4-butan-2-yloxybutyl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 169257394 |
| Molecular Formula | C21H29N3O4 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | 3-(7-amino-3-oxo-1H-isoindol-2-yl)-1-(4-butan-2-yloxybutyl)piperidine-2,6-dione |
| SMILES | CCC(C)OCCCCN1C(=O)CCC(N2Cc3c(N)cccc3C2=O)C1=O |
| InChI | InChI=1S/C21H29N3O4/c1-3-14(2)28-12-5-4-11-23-19(25)10-9-18(21(23)27)24-13-16-15(20(24)26)7-6-8-17(16)22/h6-8,14,18H,3-5,9-13,22H2,1-2H3 |
| InChIKey | KQKIPEVATMVKDO-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|