C38H38N6O4S — CID 165021577
3-(7-amino-3-oxo-1H-isoindol-2-yl)-1-[2-[3-[2-[4-[6-(dimethylamino)-3-pyridinyl]phenyl]-1,3-benzothiazol-6-yl]propoxy]ethyl]piperidine-2,6-dione (PubChem CID 165021577) has the molecular formula C38H38N6O4S and a molecular weight of 674.83 g/mol. Its IUPAC name is 3-(7-amino-3-oxo-1H-isoindol-2-yl)-1-[2-[3-[2-[4-[6-(dimethylamino)-3-pyridinyl]phenyl]-1,3-benzothiazol-6-yl]propoxy]ethyl]piperidine-2,6-dione.
| Compound Name | 3-(7-amino-3-oxo-1H-isoindol-2-yl)-1-[2-[3-[2-[4-[6-(dimethylamino)-3-pyridinyl]phenyl]-1,3-benzothiazol-6-yl]propoxy]ethyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 165021577 |
| Molecular Formula | C38H38N6O4S |
| Molecular Weight | 674.83 g/mol |
| Exact Mass | 674.27 |
| IUPAC Name | 3-(7-amino-3-oxo-1H-isoindol-2-yl)-1-[2-[3-[2-[4-[6-(dimethylamino)-3-pyridinyl]phenyl]-1,3-benzothiazol-6-yl]propoxy]ethyl]piperidine-2,6-dione |
| SMILES | CN(C)c1ccc(-c2ccc(-c3nc4ccc(CCCOCCN5C(=O)CCC(N6Cc7c(N)cccc7C6=O)C5=O)cc4s3)cc2)cn1 |
| InChI | InChI=1S/C38H38N6O4S/c1-42(2)34-16-13-27(22-40-34)25-9-11-26(12-10-25)36-41-31-14-8-24(21-33(31)49-36)5-4-19-48-20-18-43-35(45)17-15-32(38(43)47)44-23-29-28(37(44)46)6-3-7-30(29)39/h3,6-14,16,21-22,32H,4-5,15,17-20,23,39H2,1-2H3 |
| InChIKey | LFUPPQNNLRAJJR-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 121.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.83 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|