C41H41N5O5S — CID 165022092
3-[6-[7-[2-[4-[6-(dimethylamino)-3-pyridinyl]-2-methylphenyl]-1,3-benzothiazol-6-yl]-2-oxoheptoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 165022092) has the molecular formula C41H41N5O5S and a molecular weight of 715.88 g/mol. Its IUPAC name is 3-[6-[7-[2-[4-[6-(dimethylamino)-3-pyridinyl]-2-methylphenyl]-1,3-benzothiazol-6-yl]-2-oxoheptoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[7-[2-[4-[6-(dimethylamino)-3-pyridinyl]-2-methylphenyl]-1,3-benzothiazol-6-yl]-2-oxoheptoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 165022092 |
| Molecular Formula | C41H41N5O5S |
| Molecular Weight | 715.88 g/mol |
| Exact Mass | 715.28 |
| IUPAC Name | 3-[6-[7-[2-[4-[6-(dimethylamino)-3-pyridinyl]-2-methylphenyl]-1,3-benzothiazol-6-yl]-2-oxoheptoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | Cc1cc(-c2ccc(N(C)C)nc2)ccc1-c1nc2ccc(CCCCCC(=O)COc3ccc4c(c3)CN(C3CCC(=O)NC3=O)C4=O)cc2s1 |
| InChI | InChI=1S/C41H41N5O5S/c1-25-19-27(28-11-17-37(42-22-28)45(2)3)10-13-32(25)40-43-34-15-9-26(20-36(34)52-40)7-5-4-6-8-30(47)24-51-31-12-14-33-29(21-31)23-46(41(33)50)35-16-18-38(48)44-39(35)49/h9-15,17,19-22,35H,4-8,16,18,23-24H2,1-3H3,(H,44,48,49) |
| InChIKey | ARIOGQBJPOXKNV-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.88 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|