C37H35N5O6S — CID 164951120
3-[6-[2-[3-[5-[5-(6-methoxy-1,3-benzothiazol-2-yl)-4-methyl-2-pyridinyl]-2-pyridinyl]propoxy]ethoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 164951120) has the molecular formula C37H35N5O6S and a molecular weight of 677.78 g/mol. Its IUPAC name is 3-[6-[2-[3-[5-[5-(6-methoxy-1,3-benzothiazol-2-yl)-4-methyl-2-pyridinyl]-2-pyridinyl]propoxy]ethoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[2-[3-[5-[5-(6-methoxy-1,3-benzothiazol-2-yl)-4-methyl-2-pyridinyl]-2-pyridinyl]propoxy]ethoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 164951120 |
| Molecular Formula | C37H35N5O6S |
| Molecular Weight | 677.78 g/mol |
| Exact Mass | 677.23 |
| IUPAC Name | 3-[6-[2-[3-[5-[5-(6-methoxy-1,3-benzothiazol-2-yl)-4-methyl-2-pyridinyl]-2-pyridinyl]propoxy]ethoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | COc1ccc2nc(-c3cnc(-c4ccc(CCCOCCOc5ccc6c(c5)CN(C5CCC(=O)NC5=O)C6=O)nc4)cc3C)sc2c1 |
| InChI | InChI=1S/C37H35N5O6S/c1-22-16-31(39-20-29(22)36-40-30-10-8-26(46-2)18-33(30)49-36)23-5-6-25(38-19-23)4-3-13-47-14-15-48-27-7-9-28-24(17-27)21-42(37(28)45)32-11-12-34(43)41-35(32)44/h5-10,16-20,32H,3-4,11-15,21H2,1-2H3,(H,41,43,44) |
| InChIKey | UJMMESMEOBYEPA-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 132.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.78 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|