C37H35N5O6S — CID 165060715
3-[6-[2-[2-[[5-[4-(6-methoxy-1,3-benzothiazol-2-yl)-3-methylphenyl]-2-pyridinyl]amino]ethoxy]ethoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 165060715) has the molecular formula C37H35N5O6S and a molecular weight of 677.78 g/mol. Its IUPAC name is 3-[6-[2-[2-[[5-[4-(6-methoxy-1,3-benzothiazol-2-yl)-3-methylphenyl]-2-pyridinyl]amino]ethoxy]ethoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[2-[2-[[5-[4-(6-methoxy-1,3-benzothiazol-2-yl)-3-methylphenyl]-2-pyridinyl]amino]ethoxy]ethoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 165060715 |
| Molecular Formula | C37H35N5O6S |
| Molecular Weight | 677.78 g/mol |
| Exact Mass | 677.23 |
| IUPAC Name | 3-[6-[2-[2-[[5-[4-(6-methoxy-1,3-benzothiazol-2-yl)-3-methylphenyl]-2-pyridinyl]amino]ethoxy]ethoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | COc1ccc2nc(-c3ccc(-c4ccc(NCCOCCOc5ccc6c(c5)CN(C5CCC(=O)NC5=O)C6=O)nc4)cc3C)sc2c1 |
| InChI | InChI=1S/C37H35N5O6S/c1-22-17-23(3-7-28(22)36-40-30-9-6-26(46-2)19-32(30)49-36)24-4-11-33(39-20-24)38-13-14-47-15-16-48-27-5-8-29-25(18-27)21-42(37(29)45)31-10-12-34(43)41-35(31)44/h3-9,11,17-20,31H,10,12-16,21H2,1-2H3,(H,38,39)(H,41,43,44) |
| InChIKey | YTEDHEZTLJRFOB-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 131.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.78 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|