C22H25F3N2O10 — CID 175703596
3-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]oxy]ethoxy]ethoxy]propanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 175703596) has the molecular formula C22H25F3N2O10 and a molecular weight of 534.44 g/mol. Its IUPAC name is 3-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]oxy]ethoxy]ethoxy]propanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]oxy]ethoxy]ethoxy]propanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 175703596 |
| Molecular Formula | C22H25F3N2O10 |
| Molecular Weight | 534.44 g/mol |
| Exact Mass | 534.15 |
| IUPAC Name | 3-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]oxy]ethoxy]ethoxy]propanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C(O)CCOCCOCCOc1ccc2c(c1)CN(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C20H24N2O8.C2HF3O2/c23-17-4-3-16(19(26)21-17)22-12-13-11-14(1-2-15(13)20(22)27)30-10-9-29-8-7-28-6-5-18(24)25;3-2(4,5)1(6)7/h1-2,11,16H,3-10,12H2,(H,24,25)(H,21,23,26);(H,6,7) |
| InChIKey | FLGBKVGAFCHWBV-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 168.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.44 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|