C24H24FN3O4 — CID 166468961
(3R)-3-[6-[2-[3-(4-fluorophenyl)azetidin-1-yl]ethoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 166468961) has the molecular formula C24H24FN3O4 and a molecular weight of 437.47 g/mol. Its IUPAC name is (3R)-3-[6-[2-[3-(4-fluorophenyl)azetidin-1-yl]ethoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | (3R)-3-[6-[2-[3-(4-fluorophenyl)azetidin-1-yl]ethoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 166468961 |
| Molecular Formula | C24H24FN3O4 |
| Molecular Weight | 437.47 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | (3R)-3-[6-[2-[3-(4-fluorophenyl)azetidin-1-yl]ethoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CC[C@@H](N2Cc3cc(OCCN4CC(c5ccc(F)cc5)C4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C24H24FN3O4/c25-18-3-1-15(2-4-18)17-12-27(13-17)9-10-32-19-5-6-20-16(11-19)14-28(24(20)31)21-7-8-22(29)26-23(21)30/h1-6,11,17,21H,7-10,12-14H2,(H,26,29,30)/t21-/m1/s1 |
| InChIKey | UEVFULOHJYXHFJ-OAQYLSRUSA-N |
| XLogP | 2.06 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.47 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|