C25H25N5O4 — CID 166469512
3-[6-[2-[3-(1H-indazol-5-yl)azetidin-1-yl]ethoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 166469512) has the molecular formula C25H25N5O4 and a molecular weight of 459.51 g/mol. Its IUPAC name is 3-[6-[2-[3-(1H-indazol-5-yl)azetidin-1-yl]ethoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[2-[3-(1H-indazol-5-yl)azetidin-1-yl]ethoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 166469512 |
| Molecular Formula | C25H25N5O4 |
| Molecular Weight | 459.51 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | 3-[6-[2-[3-(1H-indazol-5-yl)azetidin-1-yl]ethoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(OCCN4CC(c5ccc6[nH]ncc6c5)C4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C25H25N5O4/c31-23-6-5-22(24(32)27-23)30-14-17-10-19(2-3-20(17)25(30)33)34-8-7-29-12-18(13-29)15-1-4-21-16(9-15)11-26-28-21/h1-4,9-11,18,22H,5-8,12-14H2,(H,26,28)(H,27,31,32) |
| InChIKey | JRFVCNMHGHZEQV-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 107.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.51 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|