C27H26N4O4 — CID 174197860
(3S)-3-[6-[(3S)-1-(isoquinolin-3-ylmethyl)pyrrolidin-3-yl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 174197860) has the molecular formula C27H26N4O4 and a molecular weight of 470.53 g/mol. Its IUPAC name is (3S)-3-[6-[(3S)-1-(isoquinolin-3-ylmethyl)pyrrolidin-3-yl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | (3S)-3-[6-[(3S)-1-(isoquinolin-3-ylmethyl)pyrrolidin-3-yl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 174197860 |
| Molecular Formula | C27H26N4O4 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.20 |
| IUPAC Name | (3S)-3-[6-[(3S)-1-(isoquinolin-3-ylmethyl)pyrrolidin-3-yl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CC[C@H](N2Cc3cc(O[C@H]4CCN(Cc5cc6ccccc6cn5)C4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C27H26N4O4/c32-25-8-7-24(26(33)29-25)31-14-19-12-21(5-6-23(19)27(31)34)35-22-9-10-30(16-22)15-20-11-17-3-1-2-4-18(17)13-28-20/h1-6,11-13,22,24H,7-10,14-16H2,(H,29,32,33)/t22-,24-/m0/s1 |
| InChIKey | ULPTVFKKKIPUCY-UPVQGACJSA-N |
| XLogP | 2.65 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|