C26H25N5O4 — CID 170708255
3-[6-[(3S)-1-(2,6-naphthyridin-3-ylmethyl)pyrrolidin-3-yl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 170708255) has the molecular formula C26H25N5O4 and a molecular weight of 471.52 g/mol. Its IUPAC name is 3-[6-[(3S)-1-(2,6-naphthyridin-3-ylmethyl)pyrrolidin-3-yl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[(3S)-1-(2,6-naphthyridin-3-ylmethyl)pyrrolidin-3-yl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 170708255 |
| Molecular Formula | C26H25N5O4 |
| Molecular Weight | 471.52 g/mol |
| Exact Mass | 471.19 |
| IUPAC Name | 3-[6-[(3S)-1-(2,6-naphthyridin-3-ylmethyl)pyrrolidin-3-yl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(O[C@H]4CCN(Cc5cc6cnccc6cn5)C4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C26H25N5O4/c32-24-4-3-23(25(33)29-24)31-13-18-10-20(1-2-22(18)26(31)34)35-21-6-8-30(15-21)14-19-9-17-11-27-7-5-16(17)12-28-19/h1-2,5,7,9-12,21,23H,3-4,6,8,13-15H2,(H,29,32,33)/t21-,23?/m0/s1 |
| InChIKey | KYHRXJFLOWLIPG-BBQAJUCSSA-N |
| XLogP | 2.04 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.52 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|