C23H21N3O6 — CID 134492902
3-[6-[2-[3-(5-hydroxy-2-pyridinyl)prop-2-ynoxy]ethoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 134492902) has the molecular formula C23H21N3O6 and a molecular weight of 435.44 g/mol. Its IUPAC name is 3-[6-[2-[3-(5-hydroxy-2-pyridinyl)prop-2-ynoxy]ethoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[2-[3-(5-hydroxy-2-pyridinyl)prop-2-ynoxy]ethoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 134492902 |
| Molecular Formula | C23H21N3O6 |
| Molecular Weight | 435.44 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | 3-[6-[2-[3-(5-hydroxy-2-pyridinyl)prop-2-ynoxy]ethoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(OCCOCC#Cc4ccc(O)cn4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C23H21N3O6/c27-17-4-3-16(24-13-17)2-1-9-31-10-11-32-18-5-6-19-15(12-18)14-26(23(19)30)20-7-8-21(28)25-22(20)29/h3-6,12-13,20,27H,7-11,14H2,(H,25,28,29) |
| InChIKey | NPHVLILTKXNTPB-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 118.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.44 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|