C21H26N2O4 — CID 155331384
3-[6-[(4-methylcyclohexyl)methoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 155331384) has the molecular formula C21H26N2O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is 3-[6-[(4-methylcyclohexyl)methoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[(4-methylcyclohexyl)methoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 155331384 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | 3-[6-[(4-methylcyclohexyl)methoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | CC1CCC(COc2ccc3c(c2)CN(C2CCC(=O)NC2=O)C3=O)CC1 |
| InChI | InChI=1S/C21H26N2O4/c1-13-2-4-14(5-3-13)12-27-16-6-7-17-15(10-16)11-23(21(17)26)18-8-9-19(24)22-20(18)25/h6-7,10,13-14,18H,2-5,8-9,11-12H2,1H3,(H,22,24,25) |
| InChIKey | FASQQMFQTGFTCV-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|