C25H33N3O8 — CID 176700072
3-[6-[3-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]prop-1-ynyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione;N-propan-2-ylidenehydroxylamine (PubChem CID 176700072) has the molecular formula C25H33N3O8 and a molecular weight of 503.55 g/mol. Its IUPAC name is 3-[6-[3-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]prop-1-ynyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione;N-propan-2-ylidenehydroxylamine.
| Compound Name | 3-[6-[3-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]prop-1-ynyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione;N-propan-2-ylidenehydroxylamine |
|---|---|
| PubChem CID | 176700072 |
| Molecular Formula | C25H33N3O8 |
| Molecular Weight | 503.55 g/mol |
| Exact Mass | 503.23 |
| IUPAC Name | 3-[6-[3-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]prop-1-ynyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione;N-propan-2-ylidenehydroxylamine |
| SMILES | CC(C)=NO.O=C1CCC(N2Cc3cc(C#CCOCCOCCOCCO)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C22H26N2O7.C3H7NO/c25-7-9-30-11-13-31-12-10-29-8-1-2-16-3-4-18-17(14-16)15-24(22(18)28)19-5-6-20(26)23-21(19)27;1-3(2)4-5/h3-4,14,19,25H,5-13,15H2,(H,23,26,27);5H,1-2H3 |
| InChIKey | NDVFOARHIUQDDD-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 146.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.55 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|