C19H17N3O5 — CID 171772382
2-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]ethynyl azetidine-1-carboxylate (PubChem CID 171772382) has the molecular formula C19H17N3O5 and a molecular weight of 367.36 g/mol. Its IUPAC name is 2-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]ethynyl azetidine-1-carboxylate.
| Compound Name | 2-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]ethynyl azetidine-1-carboxylate |
|---|---|
| PubChem CID | 171772382 |
| Molecular Formula | C19H17N3O5 |
| Molecular Weight | 367.36 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | 2-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]ethynyl azetidine-1-carboxylate |
| SMILES | O=C1CCC(N2Cc3cc(C#COC(=O)N4CCC4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C19H17N3O5/c23-16-5-4-15(17(24)20-16)22-11-13-10-12(2-3-14(13)18(22)25)6-9-27-19(26)21-7-1-8-21/h2-3,10,15H,1,4-5,7-8,11H2,(H,20,23,24) |
| InChIKey | IGWYTXUBJFMVNA-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.36 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|