C25H23ClN4O4 — CID 166468829
5-chloro-2-[1-[2-[[2-[(3S)-2,6-dioxopiperidin-3-yl]-1-oxo-3H-isoindol-5-yl]oxy]ethyl]azetidin-3-yl]benzonitrile (PubChem CID 166468829) has the molecular formula C25H23ClN4O4 and a molecular weight of 478.94 g/mol. Its IUPAC name is 5-chloro-2-[1-[2-[[2-[(3S)-2,6-dioxopiperidin-3-yl]-1-oxo-3H-isoindol-5-yl]oxy]ethyl]azetidin-3-yl]benzonitrile.
| Compound Name | 5-chloro-2-[1-[2-[[2-[(3S)-2,6-dioxopiperidin-3-yl]-1-oxo-3H-isoindol-5-yl]oxy]ethyl]azetidin-3-yl]benzonitrile |
|---|---|
| PubChem CID | 166468829 |
| Molecular Formula | C25H23ClN4O4 |
| Molecular Weight | 478.94 g/mol |
| Exact Mass | 478.14 |
| IUPAC Name | 5-chloro-2-[1-[2-[[2-[(3S)-2,6-dioxopiperidin-3-yl]-1-oxo-3H-isoindol-5-yl]oxy]ethyl]azetidin-3-yl]benzonitrile |
| SMILES | N#Cc1cc(Cl)ccc1C1CN(CCOc2ccc3c(c2)CN([C@H]2CCC(=O)NC2=O)C3=O)C1 |
| InChI | InChI=1S/C25H23ClN4O4/c26-18-1-3-20(15(9-18)11-27)17-12-29(13-17)7-8-34-19-2-4-21-16(10-19)14-30(25(21)33)22-5-6-23(31)28-24(22)32/h1-4,9-10,17,22H,5-8,12-14H2,(H,28,31,32)/t22-/m0/s1 |
| InChIKey | ODXVDTGUMCXIHL-QFIPXVFZSA-N |
| XLogP | 2.45 |
| TPSA | 102.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.94 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|