C28H27ClN4O4 — CID 166468869
5-chloro-2-[1-[(2S)-2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]oxy]cyclopentyl]azetidin-3-yl]benzonitrile (PubChem CID 166468869) has the molecular formula C28H27ClN4O4 and a molecular weight of 519.00 g/mol. Its IUPAC name is 5-chloro-2-[1-[(2S)-2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]oxy]cyclopentyl]azetidin-3-yl]benzonitrile.
| Compound Name | 5-chloro-2-[1-[(2S)-2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]oxy]cyclopentyl]azetidin-3-yl]benzonitrile |
|---|---|
| PubChem CID | 166468869 |
| Molecular Formula | C28H27ClN4O4 |
| Molecular Weight | 519.00 g/mol |
| Exact Mass | 518.17 |
| IUPAC Name | 5-chloro-2-[1-[(2S)-2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]oxy]cyclopentyl]azetidin-3-yl]benzonitrile |
| SMILES | N#Cc1cc(Cl)ccc1C1CN(C2CCC[C@@H]2Oc2ccc3c(c2)CN(C2CCC(=O)NC2=O)C3=O)C1 |
| InChI | InChI=1S/C28H27ClN4O4/c29-19-4-6-21(16(10-19)12-30)18-13-32(14-18)23-2-1-3-25(23)37-20-5-7-22-17(11-20)15-33(28(22)36)24-8-9-26(34)31-27(24)35/h4-7,10-11,18,23-25H,1-3,8-9,13-15H2,(H,31,34,35)/t23?,24?,25-/m0/s1 |
| InChIKey | OXAOBLMMSKVSTA-STEQJIOHSA-N |
| XLogP | 3.37 |
| TPSA | 102.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.00 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|