C29H29ClN4O4 — CID 169030305
3-chloro-4-[1-[(1R,2R)-2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]oxy]cyclohexyl]azetidin-3-yl]benzonitrile (PubChem CID 169030305) has the molecular formula C29H29ClN4O4 and a molecular weight of 533.03 g/mol. Its IUPAC name is 3-chloro-4-[1-[(1R,2R)-2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]oxy]cyclohexyl]azetidin-3-yl]benzonitrile.
| Compound Name | 3-chloro-4-[1-[(1R,2R)-2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]oxy]cyclohexyl]azetidin-3-yl]benzonitrile |
|---|---|
| PubChem CID | 169030305 |
| Molecular Formula | C29H29ClN4O4 |
| Molecular Weight | 533.03 g/mol |
| Exact Mass | 532.19 |
| IUPAC Name | 3-chloro-4-[1-[(1R,2R)-2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]oxy]cyclohexyl]azetidin-3-yl]benzonitrile |
| SMILES | N#Cc1ccc(C2CN([C@@H]3CCCC[C@H]3Oc3ccc4c(c3)CN(C3CCC(=O)NC3=O)C4=O)C2)c(Cl)c1 |
| InChI | InChI=1S/C29H29ClN4O4/c30-23-11-17(13-31)5-7-21(23)19-14-33(15-19)24-3-1-2-4-26(24)38-20-6-8-22-18(12-20)16-34(29(22)37)25-9-10-27(35)32-28(25)36/h5-8,11-12,19,24-26H,1-4,9-10,14-16H2,(H,32,35,36)/t24-,25?,26-/m1/s1 |
| InChIKey | VVAWSIVQULOUDG-NCKFGJJNSA-N |
| XLogP | 3.76 |
| TPSA | 102.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.03 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|