C32H42N4O6 — CID 156792001
3-[6-[6-[[2-(2-morpholin-4-ylethoxy)phenyl]methylamino]hexoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 156792001) has the molecular formula C32H42N4O6 and a molecular weight of 578.71 g/mol. Its IUPAC name is 3-[6-[6-[[2-(2-morpholin-4-ylethoxy)phenyl]methylamino]hexoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[6-[[2-(2-morpholin-4-ylethoxy)phenyl]methylamino]hexoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 156792001 |
| Molecular Formula | C32H42N4O6 |
| Molecular Weight | 578.71 g/mol |
| Exact Mass | 578.31 |
| IUPAC Name | 3-[6-[6-[[2-(2-morpholin-4-ylethoxy)phenyl]methylamino]hexoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(OCCCCCCNCc4ccccc4OCCN4CCOCC4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C32H42N4O6/c37-30-12-11-28(31(38)34-30)36-23-25-21-26(9-10-27(25)32(36)39)41-17-6-2-1-5-13-33-22-24-7-3-4-8-29(24)42-20-16-35-14-18-40-19-15-35/h3-4,7-10,21,28,33H,1-2,5-6,11-20,22-23H2,(H,34,37,38) |
| InChIKey | UEMWMKUPLJOYBO-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 109.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.71 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|