C25H31N3O5 — CID 156792030
N-[6-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]oxy]hexyl]bicyclo[1.1.1]pentane-1-carboxamide (PubChem CID 156792030) has the molecular formula C25H31N3O5 and a molecular weight of 453.54 g/mol. Its IUPAC name is N-[6-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]oxy]hexyl]bicyclo[1.1.1]pentane-1-carboxamide.
| Compound Name | N-[6-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]oxy]hexyl]bicyclo[1.1.1]pentane-1-carboxamide |
|---|---|
| PubChem CID | 156792030 |
| Molecular Formula | C25H31N3O5 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.23 |
| IUPAC Name | N-[6-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]oxy]hexyl]bicyclo[1.1.1]pentane-1-carboxamide |
| SMILES | O=C1CCC(N2Cc3cc(OCCCCCCNC(=O)C45CC(C4)C5)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C25H31N3O5/c29-21-8-7-20(22(30)27-21)28-15-17-11-18(5-6-19(17)23(28)31)33-10-4-2-1-3-9-26-24(32)25-12-16(13-25)14-25/h5-6,11,16,20H,1-4,7-10,12-15H2,(H,26,32)(H,27,29,30) |
| InChIKey | OUQAGZNHIZUJGK-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|