C28H35N5O5S — CID 156792089
N-[6-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]oxy]hexyl]-2-piperidin-1-yl-1,3-thiazole-5-carboxamide (PubChem CID 156792089) has the molecular formula C28H35N5O5S and a molecular weight of 553.69 g/mol. Its IUPAC name is N-[6-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]oxy]hexyl]-2-piperidin-1-yl-1,3-thiazole-5-carboxamide.
| Compound Name | N-[6-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]oxy]hexyl]-2-piperidin-1-yl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 156792089 |
| Molecular Formula | C28H35N5O5S |
| Molecular Weight | 553.69 g/mol |
| Exact Mass | 553.24 |
| IUPAC Name | N-[6-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]oxy]hexyl]-2-piperidin-1-yl-1,3-thiazole-5-carboxamide |
| SMILES | O=C1CCC(N2Cc3cc(OCCCCCCNC(=O)c4cnc(N5CCCCC5)s4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C28H35N5O5S/c34-24-11-10-22(25(35)31-24)33-18-19-16-20(8-9-21(19)27(33)37)38-15-7-2-1-4-12-29-26(36)23-17-30-28(39-23)32-13-5-3-6-14-32/h8-9,16-17,22H,1-7,10-15,18H2,(H,29,36)(H,31,34,35) |
| InChIKey | GKARVBVUNJMYQL-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 120.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.69 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|